C20H30N4O5 — CID 3733336
methyl 1-[1-(3-methylbut-2-enoyl)-4-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate (PubChem CID 3733336) has the molecular formula C20H30N4O5 and a molecular weight of 406.48 g/mol. Its IUPAC name is methyl 1-[1-(3-methylbut-2-enoyl)-4-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[1-(3-methylbut-2-enoyl)-4-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 3733336 |
| Molecular Formula | C20H30N4O5 |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.22 |
| IUPAC Name | methyl 1-[1-(3-methylbut-2-enoyl)-4-(prop-2-enylcarbamoylamino)pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylate |
| SMILES | C=CCNC(=O)NC1CC(C(=O)N2CCCC2C(=O)OC)N(C(=O)C=C(C)C)C1 |
| InChI | InChI=1S/C20H30N4O5/c1-5-8-21-20(28)22-14-11-16(24(12-14)17(25)10-13(2)3)18(26)23-9-6-7-15(23)19(27)29-4/h5,10,14-16H,1,6-9,11-12H2,2-4H3,(H2,21,22,28) |
| InChIKey | ZDWVHHNFPBIXRU-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|