C28H38N2O3 — CID 3733399
4-hydroxy-4a,5-dimethyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 3733399) has the molecular formula C28H38N2O3 and a molecular weight of 450.62 g/mol. Its IUPAC name is 4-hydroxy-4a,5-dimethyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | 4-hydroxy-4a,5-dimethyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 3733399 |
| Molecular Formula | C28H38N2O3 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.29 |
| IUPAC Name | 4-hydroxy-4a,5-dimethyl-3-[[4-(3-phenylprop-2-enyl)piperazin-1-yl]methyl]-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | CC1CCC=C2CC3OC(=O)C(CN4CCN(CC=Cc5ccccc5)CC4)C3C(O)C21C |
| InChI | InChI=1S/C28H38N2O3/c1-20-8-6-12-22-18-24-25(26(31)28(20,22)2)23(27(32)33-24)19-30-16-14-29(15-17-30)13-7-11-21-9-4-3-5-10-21/h3-5,7,9-12,20,23-26,31H,6,8,13-19H2,1-2H3 |
| InChIKey | OENXBRAOGMLWJQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|