C25H32Cl2N2O3 — CID 51447802
(3S,3aS,4S,4aR,5R,9aR)-3-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 51447802) has the molecular formula C25H32Cl2N2O3 and a molecular weight of 479.45 g/mol. Its IUPAC name is (3S,3aS,4S,4aR,5R,9aR)-3-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4S,4aR,5R,9aR)-3-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 51447802 |
| Molecular Formula | C25H32Cl2N2O3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (3S,3aS,4S,4aR,5R,9aR)-3-[[4-(3,4-dichlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC=C2C[C@H]3OC(=O)[C@H](CN4CCN(c5ccc(Cl)c(Cl)c5)CC4)[C@H]3[C@H](O)[C@@]21C |
| InChI | InChI=1S/C25H32Cl2N2O3/c1-15-4-3-5-16-12-21-22(23(30)25(15,16)2)18(24(31)32-21)14-28-8-10-29(11-9-28)17-6-7-19(26)20(27)13-17/h5-7,13,15,18,21-23,30H,3-4,8-12,14H2,1-2H3/t15-,18-,21-,22-,23+,25-/m1/s1 |
| InChIKey | XJBYWFYXIAOOJI-AYYZNIGUSA-N |
| XLogP | 4.40 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|