C25H33ClN2O3 — CID 40806805
(3S,3aS,4R,4aR,5R,9aR)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 40806805) has the molecular formula C25H33ClN2O3 and a molecular weight of 445.00 g/mol. Its IUPAC name is (3S,3aS,4R,4aR,5R,9aR)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3S,3aS,4R,4aR,5R,9aR)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 40806805 |
| Molecular Formula | C25H33ClN2O3 |
| Molecular Weight | 445.00 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | (3S,3aS,4R,4aR,5R,9aR)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | C[C@@H]1CCC=C2C[C@H]3OC(=O)[C@H](CN4CCN(c5cccc(Cl)c5)CC4)[C@H]3[C@@H](O)[C@@]21C |
| InChI | InChI=1S/C25H33ClN2O3/c1-16-5-3-6-17-13-21-22(23(29)25(16,17)2)20(24(30)31-21)15-27-9-11-28(12-10-27)19-8-4-7-18(26)14-19/h4,6-8,14,16,20-23,29H,3,5,9-13,15H2,1-2H3/t16-,20-,21-,22-,23-,25-/m1/s1 |
| InChIKey | HXHILYRRLVJUGI-MGPYLOASSA-N |
| XLogP | 3.75 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|