C26H35ClN2O3 — CID 129445479
(3R,3aS,4S,4aR,5R,9aR)-3-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one (PubChem CID 129445479) has the molecular formula C26H35ClN2O3 and a molecular weight of 459.03 g/mol. Its IUPAC name is (3R,3aS,4S,4aR,5R,9aR)-3-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one.
| Compound Name | (3R,3aS,4S,4aR,5R,9aR)-3-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 129445479 |
| Molecular Formula | C26H35ClN2O3 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (3R,3aS,4S,4aR,5R,9aR)-3-[[4-(5-chloro-2-methylphenyl)piperazin-1-yl]methyl]-4-hydroxy-4a,5-dimethyl-3,3a,4,5,6,7,9,9a-octahydrobenzo[f][1]benzofuran-2-one |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C[C@@H]2C(=O)O[C@@H]3CC4=CCC[C@@H](C)[C@@]4(C)[C@@H](O)[C@H]23)CC1 |
| InChI | InChI=1S/C26H35ClN2O3/c1-16-7-8-19(27)14-21(16)29-11-9-28(10-12-29)15-20-23-22(32-25(20)31)13-18-6-4-5-17(2)26(18,3)24(23)30/h6-8,14,17,20,22-24,30H,4-5,9-13,15H2,1-3H3/t17-,20+,22-,23-,24+,26-/m1/s1 |
| InChIKey | AQMMEIYJVYEMNA-POGPOUSASA-N |
| XLogP | 4.06 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|