C26H32N4O3S2 — CID 3738089
1-[1-ethyl-2-oxo-3-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperidine-4-carboxamide (PubChem CID 3738089) has the molecular formula C26H32N4O3S2 and a molecular weight of 512.70 g/mol. Its IUPAC name is 1-[1-ethyl-2-oxo-3-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperidine-4-carboxamide.
| Compound Name | 1-[1-ethyl-2-oxo-3-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3738089 |
| Molecular Formula | C26H32N4O3S2 |
| Molecular Weight | 512.70 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | 1-[1-ethyl-2-oxo-3-[(4-oxo-3-pentyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperidine-4-carboxamide |
| SMILES | CCCCCN1C(=O)C(=Cc2c(N3CCC(C(N)=O)CC3)c3ccccc3n(CC)c2=O)SC1=S |
| InChI | InChI=1S/C26H32N4O3S2/c1-3-5-8-13-30-25(33)21(35-26(30)34)16-19-22(28-14-11-17(12-15-28)23(27)31)18-9-6-7-10-20(18)29(4-2)24(19)32/h6-7,9-10,16-17H,3-5,8,11-15H2,1-2H3,(H2,27,31) |
| InChIKey | MZXQFPKCRMEVQL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|