C25H29N3O4S2 — CID 3697752
ethyl 1-[1-ethyl-3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxoquinolin-4-yl]piperidine-4-carboxylate (PubChem CID 3697752) has the molecular formula C25H29N3O4S2 and a molecular weight of 499.66 g/mol. Its IUPAC name is ethyl 1-[1-ethyl-3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxoquinolin-4-yl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[1-ethyl-3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxoquinolin-4-yl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 3697752 |
| Molecular Formula | C25H29N3O4S2 |
| Molecular Weight | 499.66 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | ethyl 1-[1-ethyl-3-[(3-ethyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-oxoquinolin-4-yl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(c2c(C=C3SC(=S)N(CC)C3=O)c(=O)n(CC)c3ccccc23)CC1 |
| InChI | InChI=1S/C25H29N3O4S2/c1-4-27-19-10-8-7-9-17(19)21(26-13-11-16(12-14-26)24(31)32-6-3)18(22(27)29)15-20-23(30)28(5-2)25(33)34-20/h7-10,15-16H,4-6,11-14H2,1-3H3 |
| InChIKey | RQIFJVSLEDCJLM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.66 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|