C24H26N4O4S2 — CID 3712375
ethyl 4-[1-methyl-2-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperazine-1-carboxylate (PubChem CID 3712375) has the molecular formula C24H26N4O4S2 and a molecular weight of 498.63 g/mol. Its IUPAC name is ethyl 4-[1-methyl-2-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[1-methyl-2-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 3712375 |
| Molecular Formula | C24H26N4O4S2 |
| Molecular Weight | 498.63 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | ethyl 4-[1-methyl-2-oxo-3-[(4-oxo-3-prop-2-enyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]quinolin-4-yl]piperazine-1-carboxylate |
| SMILES | C=CCN1C(=O)C(=Cc2c(N3CCN(C(=O)OCC)CC3)c3ccccc3n(C)c2=O)SC1=S |
| InChI | InChI=1S/C24H26N4O4S2/c1-4-10-28-22(30)19(34-24(28)33)15-17-20(16-8-6-7-9-18(16)25(3)21(17)29)26-11-13-27(14-12-26)23(31)32-5-2/h4,6-9,15H,1,5,10-14H2,2-3H3 |
| InChIKey | RNQBANMNOMBGAF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 75.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|