C13H15N3O3 — CID 3739273
N-(2,6-dimethoxy-3-pyridinyl)-1-methylpyrrole-2-carboxamide (PubChem CID 3739273) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is N-(2,6-dimethoxy-3-pyridinyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | N-(2,6-dimethoxy-3-pyridinyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 3739273 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | N-(2,6-dimethoxy-3-pyridinyl)-1-methylpyrrole-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cccn2C)c(OC)n1 |
| InChI | InChI=1S/C13H15N3O3/c1-16-8-4-5-10(16)12(17)14-9-6-7-11(18-2)15-13(9)19-3/h4-8H,1-3H3,(H,14,17) |
| InChIKey | JNAZGEGKANVZKX-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |