C10H20NO6P — CID 3739649
2-amino-2-[2-[2-carboxyethyl(hydroxy)phosphoryl]ethyl]-3-methylbutanoic acid (PubChem CID 3739649) has the molecular formula C10H20NO6P and a molecular weight of 281.25 g/mol. Its IUPAC name is 2-amino-2-[2-[2-carboxyethyl(hydroxy)phosphoryl]ethyl]-3-methylbutanoic acid.
| Compound Name | 2-amino-2-[2-[2-carboxyethyl(hydroxy)phosphoryl]ethyl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 3739649 |
| Molecular Formula | C10H20NO6P |
| Molecular Weight | 281.25 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-amino-2-[2-[2-carboxyethyl(hydroxy)phosphoryl]ethyl]-3-methylbutanoic acid |
| SMILES | CC(C)C(N)(CCP(=O)(O)CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H20NO6P/c1-7(2)10(11,9(14)15)4-6-18(16,17)5-3-8(12)13/h7H,3-6,11H2,1-2H3,(H,12,13)(H,14,15)(H,16,17) |
| InChIKey | RHIRZGFEBGVSJD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.25 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|