C21H23N5O3 — CID 37399249
1,3-dimethyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide (PubChem CID 37399249) has the molecular formula C21H23N5O3 and a molecular weight of 393.45 g/mol. Its IUPAC name is 1,3-dimethyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide.
| Compound Name | 1,3-dimethyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
|---|---|
| PubChem CID | 37399249 |
| Molecular Formula | C21H23N5O3 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.18 |
| IUPAC Name | 1,3-dimethyl-N-(3-methyl-4-pyrrolidin-1-ylphenyl)-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxamide |
| SMILES | Cc1cc(NC(=O)c2ccc3c(=O)n(C)c(=O)n(C)c3n2)ccc1N1CCCC1 |
| InChI | InChI=1S/C21H23N5O3/c1-13-12-14(6-9-17(13)26-10-4-5-11-26)22-19(27)16-8-7-15-18(23-16)24(2)21(29)25(3)20(15)28/h6-9,12H,4-5,10-11H2,1-3H3,(H,22,27) |
| InChIKey | HLRANXGOZLRKFP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 89.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|