C21H26N2O3S2 — CID 37400572
N-(4-cyclopentylsulfanylphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide (PubChem CID 37400572) has the molecular formula C21H26N2O3S2 and a molecular weight of 418.58 g/mol. Its IUPAC name is N-(4-cyclopentylsulfanylphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide.
| Compound Name | N-(4-cyclopentylsulfanylphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 37400572 |
| Molecular Formula | C21H26N2O3S2 |
| Molecular Weight | 418.58 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | N-(4-cyclopentylsulfanylphenyl)-2-[methyl-(4-methylphenyl)sulfonylamino]acetamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)CC(=O)Nc2ccc(SC3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C21H26N2O3S2/c1-16-7-13-20(14-8-16)28(25,26)23(2)15-21(24)22-17-9-11-19(12-10-17)27-18-5-3-4-6-18/h7-14,18H,3-6,15H2,1-2H3,(H,22,24) |
| InChIKey | IPJOQAAGKADPCR-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |