C16H21N3O — CID 37403956
2,2-dimethyl-4-[(4-methylquinazolin-2-yl)methyl]morpholine (PubChem CID 37403956) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is 2,2-dimethyl-4-[(4-methylquinazolin-2-yl)methyl]morpholine.
| Compound Name | 2,2-dimethyl-4-[(4-methylquinazolin-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 37403956 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | 2,2-dimethyl-4-[(4-methylquinazolin-2-yl)methyl]morpholine |
| SMILES | Cc1nc(CN2CCOC(C)(C)C2)nc2ccccc12 |
| InChI | InChI=1S/C16H21N3O/c1-12-13-6-4-5-7-14(13)18-15(17-12)10-19-8-9-20-16(2,3)11-19/h4-7H,8-11H2,1-3H3 |
| InChIKey | DNKJEESEUZFXCE-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |