C16H18ClNO3 — CID 37408098
N-[3-chloro-4-(2-methylpropoxy)phenyl]-5-methylfuran-2-carboxamide (PubChem CID 37408098) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methylpropoxy)phenyl]-5-methylfuran-2-carboxamide.
| Compound Name | N-[3-chloro-4-(2-methylpropoxy)phenyl]-5-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 37408098 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[3-chloro-4-(2-methylpropoxy)phenyl]-5-methylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(OCC(C)C)c(Cl)c2)o1 |
| InChI | InChI=1S/C16H18ClNO3/c1-10(2)9-20-14-7-5-12(8-13(14)17)18-16(19)15-6-4-11(3)21-15/h4-8,10H,9H2,1-3H3,(H,18,19) |
| InChIKey | HEFJJJNZAYRSLG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |