C18H21ClN2O4S — CID 55599362
N-[3-chloro-4-(2-methylpropoxy)phenyl]-2-methyl-5-sulfamoylbenzamide (PubChem CID 55599362) has the molecular formula C18H21ClN2O4S and a molecular weight of 396.90 g/mol. Its IUPAC name is N-[3-chloro-4-(2-methylpropoxy)phenyl]-2-methyl-5-sulfamoylbenzamide.
| Compound Name | N-[3-chloro-4-(2-methylpropoxy)phenyl]-2-methyl-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 55599362 |
| Molecular Formula | C18H21ClN2O4S |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-[3-chloro-4-(2-methylpropoxy)phenyl]-2-methyl-5-sulfamoylbenzamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1C(=O)Nc1ccc(OCC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C18H21ClN2O4S/c1-11(2)10-25-17-7-5-13(8-16(17)19)21-18(22)15-9-14(26(20,23)24)6-4-12(15)3/h4-9,11H,10H2,1-3H3,(H,21,22)(H2,20,23,24) |
| InChIKey | AZGYMRYQYYMOTM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |