C23H23N3O3 — CID 37416253
methyl 4-[[(3-cyclopropyl-1-phenylpyrazole-5-carbonyl)-methylamino]methyl]benzoate (PubChem CID 37416253) has the molecular formula C23H23N3O3 and a molecular weight of 389.46 g/mol. Its IUPAC name is methyl 4-[[(3-cyclopropyl-1-phenylpyrazole-5-carbonyl)-methylamino]methyl]benzoate.
| Compound Name | methyl 4-[[(3-cyclopropyl-1-phenylpyrazole-5-carbonyl)-methylamino]methyl]benzoate |
|---|---|
| PubChem CID | 37416253 |
| Molecular Formula | C23H23N3O3 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | methyl 4-[[(3-cyclopropyl-1-phenylpyrazole-5-carbonyl)-methylamino]methyl]benzoate |
| SMILES | COC(=O)c1ccc(CN(C)C(=O)c2cc(C3CC3)nn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H23N3O3/c1-25(15-16-8-10-18(11-9-16)23(28)29-2)22(27)21-14-20(17-12-13-17)24-26(21)19-6-4-3-5-7-19/h3-11,14,17H,12-13,15H2,1-2H3 |
| InChIKey | XHONLZCDTMNVOV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |