C19H21N3O3 — CID 8998870
[(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-cyclopropyl-1-phenylpyrazole-5-carboxylate (PubChem CID 8998870) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-cyclopropyl-1-phenylpyrazole-5-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-cyclopropyl-1-phenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 8998870 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | [(2S)-1-oxo-1-(prop-2-enylamino)propan-2-yl] 3-cyclopropyl-1-phenylpyrazole-5-carboxylate |
| SMILES | C=CCNC(=O)[C@H](C)OC(=O)c1cc(C2CC2)nn1-c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-3-11-20-18(23)13(2)25-19(24)17-12-16(14-9-10-14)21-22(17)15-7-5-4-6-8-15/h3-8,12-14H,1,9-11H2,2H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | ZOQMRDAOCSHQEC-ZDUSSCGKSA-N |
| XLogP | 2.60 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|