C10H12N6O4S4 — CID 3742434
4-[2-[2-[(4-carboxy-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylic acid (PubChem CID 3742434) has the molecular formula C10H12N6O4S4 and a molecular weight of 408.51 g/mol. Its IUPAC name is 4-[2-[2-[(4-carboxy-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylic acid.
| Compound Name | 4-[2-[2-[(4-carboxy-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylic acid |
|---|---|
| PubChem CID | 3742434 |
| Molecular Formula | C10H12N6O4S4 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 4-[2-[2-[(4-carboxy-1,2,5-thiadiazol-3-yl)amino]ethyldisulfanyl]ethylamino]-1,2,5-thiadiazole-3-carboxylic acid |
| SMILES | O=C(O)c1nsnc1NCCSSCCNc1nsnc1C(=O)O |
| InChI | InChI=1S/C10H12N6O4S4/c17-9(18)5-7(15-23-13-5)11-1-3-21-22-4-2-12-8-6(10(19)20)14-24-16-8/h1-4H2,(H,11,15)(H,12,16)(H,17,18)(H,19,20) |
| InChIKey | RIPYTPLCEZKJNE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 150.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|