C26H17ClN4O5 — CID 3742939
3-(2-chloroquinolin-3-yl)-5-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 3742939) has the molecular formula C26H17ClN4O5 and a molecular weight of 500.90 g/mol. Its IUPAC name is 3-(2-chloroquinolin-3-yl)-5-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 3-(2-chloroquinolin-3-yl)-5-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 3742939 |
| Molecular Formula | C26H17ClN4O5 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | 3-(2-chloroquinolin-3-yl)-5-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON(c3ccccc3)C(c3cc4ccccc4nc3Cl)C2C(=O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C26H17ClN4O5/c27-24-19(14-15-6-4-5-9-20(15)28-24)22-21-23(36-30(22)17-7-2-1-3-8-17)26(33)29(25(21)32)16-10-12-18(13-11-16)31(34)35/h1-14,21-23H |
| InChIKey | KARGIIANLDRNMK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 105.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|