C27H20ClN3O3 — CID 98350606
(3R,3aR,6aR)-3-(2-chloroquinolin-3-yl)-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 98350606) has the molecular formula C27H20ClN3O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is (3R,3aR,6aR)-3-(2-chloroquinolin-3-yl)-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | (3R,3aR,6aR)-3-(2-chloroquinolin-3-yl)-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 98350606 |
| Molecular Formula | C27H20ClN3O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (3R,3aR,6aR)-3-(2-chloroquinolin-3-yl)-5-(4-methylphenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | Cc1ccc(N2C(=O)[C@H]3[C@@H](ON(c4ccccc4)[C@H]3c3cc4ccccc4nc3Cl)C2=O)cc1 |
| InChI | InChI=1S/C27H20ClN3O3/c1-16-11-13-18(14-12-16)30-26(32)22-23(20-15-17-7-5-6-10-21(17)29-25(20)28)31(34-24(22)27(30)33)19-8-3-2-4-9-19/h2-15,22-24H,1H3/t22-,23+,24-/m1/s1 |
| InChIKey | ZQMYTSYIOLXNNG-TZRRMPRUSA-N |
| XLogP | 5.25 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|