C10H11BrN2OS — CID 3744808
N-(2-bromophenyl)-1,3-thiazolidine-3-carboxamide (PubChem CID 3744808) has the molecular formula C10H11BrN2OS and a molecular weight of 287.18 g/mol. Its IUPAC name is N-(2-bromophenyl)-1,3-thiazolidine-3-carboxamide.
| Compound Name | N-(2-bromophenyl)-1,3-thiazolidine-3-carboxamide |
|---|---|
| PubChem CID | 3744808 |
| Molecular Formula | C10H11BrN2OS |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | N-(2-bromophenyl)-1,3-thiazolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1Br)N1CCSC1 |
| InChI | InChI=1S/C10H11BrN2OS/c11-8-3-1-2-4-9(8)12-10(14)13-5-6-15-7-13/h1-4H,5-7H2,(H,12,14) |
| InChIKey | KLHZZMNFJRYHFC-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |