C25H33FN2O3 — CID 3746241
5-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 3746241) has the molecular formula C25H33FN2O3 and a molecular weight of 428.55 g/mol. Its IUPAC name is 5-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | 5-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 3746241 |
| Molecular Formula | C25H33FN2O3 |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 5-[[4-(2-fluorophenyl)piperazin-1-yl]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | CC1CCCC2(C)CC3OC(=O)C(CN4CCN(c5ccccc5F)CC4)C3C3OC132 |
| InChI | InChI=1S/C25H33FN2O3/c1-16-6-5-9-24(2)14-20-21(22-25(16,24)31-22)17(23(29)30-20)15-27-10-12-28(13-11-27)19-8-4-3-7-18(19)26/h3-4,7-8,16-17,20-22H,5-6,9-15H2,1-2H3 |
| InChIKey | KIZXOVDPLWWWDO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|