C18H18N4O3S — CID 37473521
N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3-nitroanilino)acetamide (PubChem CID 37473521) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3-nitroanilino)acetamide.
| Compound Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3-nitroanilino)acetamide |
|---|---|
| PubChem CID | 37473521 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-2-(3-nitroanilino)acetamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)CNc3cccc([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C18H18N4O3S/c1-11-5-6-14-15(9-19)18(26-16(14)7-11)21-17(23)10-20-12-3-2-4-13(8-12)22(24)25/h2-4,8,11,20H,5-7,10H2,1H3,(H,21,23)/t11-/m0/s1 |
| InChIKey | FCJDKIQCCAQGRB-NSHDSACASA-N |
| XLogP | 3.70 |
| TPSA | 108.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|