C17H14N4O5S — CID 3490326
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3,5-dinitrobenzamide (PubChem CID 3490326) has the molecular formula C17H14N4O5S and a molecular weight of 386.39 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3,5-dinitrobenzamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 3490326 |
| Molecular Formula | C17H14N4O5S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3,5-dinitrobenzamide |
| SMILES | CC1CCc2c(sc(NC(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)c2C#N)C1 |
| InChI | InChI=1S/C17H14N4O5S/c1-9-2-3-13-14(8-18)17(27-15(13)4-9)19-16(22)10-5-11(20(23)24)7-12(6-10)21(25)26/h5-7,9H,2-4H2,1H3,(H,19,22) |
| InChIKey | MMXJWKXUFPJIIB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|