C14H13N5O3S — CID 40612329
N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-nitro-1H-pyrazole-5-carboxamide (PubChem CID 40612329) has the molecular formula C14H13N5O3S and a molecular weight of 331.36 g/mol. Its IUPAC name is N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-nitro-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 40612329 |
| Molecular Formula | C14H13N5O3S |
| Molecular Weight | 331.36 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | N-[(6S)-3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]-4-nitro-1H-pyrazole-5-carboxamide |
| SMILES | C[C@H]1CCc2c(sc(NC(=O)c3[nH]ncc3[N+](=O)[O-])c2C#N)C1 |
| InChI | InChI=1S/C14H13N5O3S/c1-7-2-3-8-9(5-15)14(23-11(8)4-7)17-13(20)12-10(19(21)22)6-16-18-12/h6-7H,2-4H2,1H3,(H,16,18)(H,17,20)/t7-/m0/s1 |
| InChIKey | OFNGSLSVXIDDBJ-ZETCQYMHSA-N |
| XLogP | 2.63 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|