C16H17N5O3S — CID 4772966
N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide (PubChem CID 4772966) has the molecular formula C16H17N5O3S and a molecular weight of 359.41 g/mol. Its IUPAC name is N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide.
| Compound Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4772966 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N-(3-cyano-6-methyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-1,5-dimethyl-4-nitropyrazole-3-carboxamide |
| SMILES | Cc1c([N+](=O)[O-])c(C(=O)Nc2sc3c(c2C#N)CCC(C)C3)nn1C |
| InChI | InChI=1S/C16H17N5O3S/c1-8-4-5-10-11(7-17)16(25-12(10)6-8)18-15(22)13-14(21(23)24)9(2)20(3)19-13/h8H,4-6H2,1-3H3,(H,18,22) |
| InChIKey | XOFUZPWNRGSEFK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 113.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|