C20H23F3N2O4S — CID 37496925
2-[(4-ethoxy-3-methylphenyl)sulfonyl-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 37496925) has the molecular formula C20H23F3N2O4S and a molecular weight of 444.48 g/mol. Its IUPAC name is 2-[(4-ethoxy-3-methylphenyl)sulfonyl-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(4-ethoxy-3-methylphenyl)sulfonyl-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 37496925 |
| Molecular Formula | C20H23F3N2O4S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2-[(4-ethoxy-3-methylphenyl)sulfonyl-ethylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCOc1ccc(S(=O)(=O)N(CC)CC(=O)Nc2ccccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C20H23F3N2O4S/c1-4-25(30(27,28)15-10-11-18(29-5-2)14(3)12-15)13-19(26)24-17-9-7-6-8-16(17)20(21,22)23/h6-12H,4-5,13H2,1-3H3,(H,24,26) |
| InChIKey | CIZCVJNFUQTDBF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |