C17H16F4N2O3S — CID 18080138
2-[ethyl-(2-fluorophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 18080138) has the molecular formula C17H16F4N2O3S and a molecular weight of 404.39 g/mol. Its IUPAC name is 2-[ethyl-(2-fluorophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[ethyl-(2-fluorophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18080138 |
| Molecular Formula | C17H16F4N2O3S |
| Molecular Weight | 404.39 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 2-[ethyl-(2-fluorophenyl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C17H16F4N2O3S/c1-2-23(27(25,26)15-10-6-4-8-13(15)18)11-16(24)22-14-9-5-3-7-12(14)17(19,20)21/h3-10H,2,11H2,1H3,(H,22,24) |
| InChIKey | LQKWTXGGQKYNEY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.39 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |