C15H17F3N4O3S — CID 47091101
2-[ethyl-(1-methylimidazol-4-yl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 47091101) has the molecular formula C15H17F3N4O3S and a molecular weight of 390.39 g/mol. Its IUPAC name is 2-[ethyl-(1-methylimidazol-4-yl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[ethyl-(1-methylimidazol-4-yl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 47091101 |
| Molecular Formula | C15H17F3N4O3S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | 2-[ethyl-(1-methylimidazol-4-yl)sulfonylamino]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCN(CC(=O)Nc1ccccc1C(F)(F)F)S(=O)(=O)c1cn(C)cn1 |
| InChI | InChI=1S/C15H17F3N4O3S/c1-3-22(26(24,25)14-9-21(2)10-19-14)8-13(23)20-12-7-5-4-6-11(12)15(16,17)18/h4-7,9-10H,3,8H2,1-2H3,(H,20,23) |
| InChIKey | LMFGSBDEVFYDDS-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |