C18H19FN2O7S — CID 3749800
N-(3-fluoro-4-methoxyphenyl)-3-methoxy-4-nitro-N-propylsulfonylbenzamide (PubChem CID 3749800) has the molecular formula C18H19FN2O7S and a molecular weight of 426.42 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-3-methoxy-4-nitro-N-propylsulfonylbenzamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-3-methoxy-4-nitro-N-propylsulfonylbenzamide |
|---|---|
| PubChem CID | 3749800 |
| Molecular Formula | C18H19FN2O7S |
| Molecular Weight | 426.42 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-3-methoxy-4-nitro-N-propylsulfonylbenzamide |
| SMILES | CCCS(=O)(=O)N(C(=O)c1ccc([N+](=O)[O-])c(OC)c1)c1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C18H19FN2O7S/c1-4-9-29(25,26)20(13-6-8-16(27-2)14(19)11-13)18(22)12-5-7-15(21(23)24)17(10-12)28-3/h5-8,10-11H,4,9H2,1-3H3 |
| InChIKey | VNVPXLQRNKMWCL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 116.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|