C16H22FNO4S — CID 3301317
N-(3-fluoro-4-methoxyphenyl)-N-propylsulfonylhex-3-enamide (PubChem CID 3301317) has the molecular formula C16H22FNO4S and a molecular weight of 343.42 g/mol. Its IUPAC name is N-(3-fluoro-4-methoxyphenyl)-N-propylsulfonylhex-3-enamide.
| Compound Name | N-(3-fluoro-4-methoxyphenyl)-N-propylsulfonylhex-3-enamide |
|---|---|
| PubChem CID | 3301317 |
| Molecular Formula | C16H22FNO4S |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | N-(3-fluoro-4-methoxyphenyl)-N-propylsulfonylhex-3-enamide |
| SMILES | CCC=CCC(=O)N(c1ccc(OC)c(F)c1)S(=O)(=O)CCC |
| InChI | InChI=1S/C16H22FNO4S/c1-4-6-7-8-16(19)18(23(20,21)11-5-2)13-9-10-15(22-3)14(17)12-13/h6-7,9-10,12H,4-5,8,11H2,1-3H3 |
| InChIKey | LXOJWYSROKUZNA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|