C17H16F5NO2S — CID 3750075
N-(4-butyl-2-methylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide (PubChem CID 3750075) has the molecular formula C17H16F5NO2S and a molecular weight of 393.38 g/mol. Its IUPAC name is N-(4-butyl-2-methylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide.
| Compound Name | N-(4-butyl-2-methylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
|---|---|
| PubChem CID | 3750075 |
| Molecular Formula | C17H16F5NO2S |
| Molecular Weight | 393.38 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(4-butyl-2-methylphenyl)-2,3,4,5,6-pentafluorobenzenesulfonamide |
| SMILES | CCCCc1ccc(NS(=O)(=O)c2c(F)c(F)c(F)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C17H16F5NO2S/c1-3-4-5-10-6-7-11(9(2)8-10)23-26(24,25)17-15(21)13(19)12(18)14(20)16(17)22/h6-8,23H,3-5H2,1-2H3 |
| InChIKey | RJYWTCYXJFHQGH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.38 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|