C18H33BrN2O2S — CID 19873369
triethyl-[4-[4-(methanesulfonamido)-3-methylphenyl]butyl]azanium bromide (PubChem CID 19873369) has the molecular formula C18H33BrN2O2S and a molecular weight of 421.45 g/mol. Its IUPAC name is triethyl-[4-[4-(methanesulfonamido)-3-methylphenyl]butyl]azanium bromide.
| Compound Name | triethyl-[4-[4-(methanesulfonamido)-3-methylphenyl]butyl]azanium bromide |
|---|---|
| PubChem CID | 19873369 |
| Molecular Formula | C18H33BrN2O2S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | triethyl-[4-[4-(methanesulfonamido)-3-methylphenyl]butyl]azanium bromide |
| SMILES | CC[N+](CC)(CC)CCCCc1ccc(NS(C)(=O)=O)c(C)c1.[Br-] |
| InChI | InChI=1S/C18H33N2O2S.BrH/c1-6-20(7-2,8-3)14-10-9-11-17-12-13-18(16(4)15-17)19-23(5,21)22;/h12-13,15,19H,6-11,14H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | GVXGOWYVWDZANW-UHFFFAOYSA-M |
| XLogP | 0.57 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|