C20H25N3O4 — CID 3750242
3-(5-cyclohexyl-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl)propanamide (PubChem CID 3750242) has the molecular formula C20H25N3O4 and a molecular weight of 371.44 g/mol. Its IUPAC name is 3-(5-cyclohexyl-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl)propanamide.
| Compound Name | 3-(5-cyclohexyl-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl)propanamide |
|---|---|
| PubChem CID | 3750242 |
| Molecular Formula | C20H25N3O4 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | 3-(5-cyclohexyl-4,6-dioxo-3-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl)propanamide |
| SMILES | NC(=O)CCN1OC2C(=O)N(C3CCCCC3)C(=O)C2C1c1ccccc1 |
| InChI | InChI=1S/C20H25N3O4/c21-15(24)11-12-22-17(13-7-3-1-4-8-13)16-18(27-22)20(26)23(19(16)25)14-9-5-2-6-10-14/h1,3-4,7-8,14,16-18H,2,5-6,9-12H2,(H2,21,24) |
| InChIKey | RHPMDDDZSYEBPH-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|