C23H31N3O5 — CID 134082937
2-[5-cyclohexyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 134082937) has the molecular formula C23H31N3O5 and a molecular weight of 429.52 g/mol. Its IUPAC name is 2-[5-cyclohexyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[5-cyclohexyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 134082937 |
| Molecular Formula | C23H31N3O5 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | 2-[5-cyclohexyl-3-(4-methylphenyl)-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)CN1OC2C(=O)N(C3CCCCC3)C(=O)C2C1c1ccc(C)cc1 |
| InChI | InChI=1S/C23H31N3O5/c1-15-8-10-16(11-9-15)20-19-21(31-25(20)14-18(27)24-12-13-30-2)23(29)26(22(19)28)17-6-4-3-5-7-17/h8-11,17,19-21H,3-7,12-14H2,1-2H3,(H,24,27) |
| InChIKey | KYTSFQROIDOSQI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|