C26H27BrN4O7 — CID 3779580
4-[[3-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]methyl]-3-nitrobenzamide (PubChem CID 3779580) has the molecular formula C26H27BrN4O7 and a molecular weight of 587.43 g/mol. Its IUPAC name is 4-[[3-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]methyl]-3-nitrobenzamide.
| Compound Name | 4-[[3-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3779580 |
| Molecular Formula | C26H27BrN4O7 |
| Molecular Weight | 587.43 g/mol |
| Exact Mass | 586.11 |
| IUPAC Name | 4-[[3-(5-bromo-2-methoxyphenyl)-5-cyclohexyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]methyl]-3-nitrobenzamide |
| SMILES | COc1ccc(Br)cc1C1C2C(=O)N(C3CCCCC3)C(=O)C2ON1Cc1ccc(C(N)=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H27BrN4O7/c1-37-20-10-9-16(27)12-18(20)22-21-23(26(34)30(25(21)33)17-5-3-2-4-6-17)38-29(22)13-15-8-7-14(24(28)32)11-19(15)31(35)36/h7-12,17,21-23H,2-6,13H2,1H3,(H2,28,32) |
| InChIKey | UHPYRNBGGNYHLL-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 145.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.43 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|