C33H33N3O7 — CID 23848036
6-benzoyl-2-cyclohexyl-5-(4,5-dimethoxy-2-nitrophenyl)-7-phenyl-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione (PubChem CID 23848036) has the molecular formula C33H33N3O7 and a molecular weight of 583.64 g/mol. Its IUPAC name is 6-benzoyl-2-cyclohexyl-5-(4,5-dimethoxy-2-nitrophenyl)-7-phenyl-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione.
| Compound Name | 6-benzoyl-2-cyclohexyl-5-(4,5-dimethoxy-2-nitrophenyl)-7-phenyl-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
|---|---|
| PubChem CID | 23848036 |
| Molecular Formula | C33H33N3O7 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | 6-benzoyl-2-cyclohexyl-5-(4,5-dimethoxy-2-nitrophenyl)-7-phenyl-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-1,3-dione |
| SMILES | COc1cc(C2C(C(=O)c3ccccc3)C(c3ccccc3)C3C(=O)N(C4CCCCC4)C(=O)N32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C33H33N3O7/c1-42-25-18-23(24(36(40)41)19-26(25)43-2)29-28(31(37)21-14-8-4-9-15-21)27(20-12-6-3-7-13-20)30-32(38)34(33(39)35(29)30)22-16-10-5-11-17-22/h3-4,6-9,12-15,18-19,22,27-30H,5,10-11,16-17H2,1-2H3 |
| InChIKey | GHSDCLKMUIUSBD-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 119.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|