C26H29N3O7 — CID 5006640
3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one (PubChem CID 5006640) has the molecular formula C26H29N3O7 and a molecular weight of 495.53 g/mol. Its IUPAC name is 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one.
| Compound Name | 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 5006640 |
| Molecular Formula | C26H29N3O7 |
| Molecular Weight | 495.53 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | 3-[1-[3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enoyl]piperidin-4-yl]-4-methyl-5-phenyl-1,3-oxazolidin-2-one |
| SMILES | COc1cc(C=CC(=O)N2CCC(N3C(=O)OC(c4ccccc4)C3C)CC2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C26H29N3O7/c1-17-25(18-7-5-4-6-8-18)36-26(31)28(17)20-11-13-27(14-12-20)24(30)10-9-19-15-22(34-2)23(35-3)16-21(19)29(32)33/h4-10,15-17,20,25H,11-14H2,1-3H3 |
| InChIKey | ZSCNRDVMFCMHNF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|