C23H20N4O6 — CID 3577709
N-[2-(4,5-dimethoxy-2-nitrophenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]benzamide (PubChem CID 3577709) has the molecular formula C23H20N4O6 and a molecular weight of 448.44 g/mol. Its IUPAC name is N-[2-(4,5-dimethoxy-2-nitrophenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]benzamide.
| Compound Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]benzamide |
|---|---|
| PubChem CID | 3577709 |
| Molecular Formula | C23H20N4O6 |
| Molecular Weight | 448.44 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-[2-(4,5-dimethoxy-2-nitrophenyl)-4-oxo-1,2-dihydroquinazolin-3-yl]benzamide |
| SMILES | COc1cc(C2Nc3ccccc3C(=O)N2NC(=O)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H20N4O6/c1-32-19-12-16(18(27(30)31)13-20(19)33-2)21-24-17-11-7-6-10-15(17)23(29)26(21)25-22(28)14-8-4-3-5-9-14/h3-13,21,24H,1-2H3,(H,25,28) |
| InChIKey | WWWKTCVDZFZVIP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|