C21H17N5O4 — CID 3402653
N-[2-(6-methyl-2-pyridinyl)-4-oxo-1,2-dihydroquinazolin-3-yl]-4-nitrobenzamide (PubChem CID 3402653) has the molecular formula C21H17N5O4 and a molecular weight of 403.40 g/mol. Its IUPAC name is N-[2-(6-methyl-2-pyridinyl)-4-oxo-1,2-dihydroquinazolin-3-yl]-4-nitrobenzamide.
| Compound Name | N-[2-(6-methyl-2-pyridinyl)-4-oxo-1,2-dihydroquinazolin-3-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 3402653 |
| Molecular Formula | C21H17N5O4 |
| Molecular Weight | 403.40 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | N-[2-(6-methyl-2-pyridinyl)-4-oxo-1,2-dihydroquinazolin-3-yl]-4-nitrobenzamide |
| SMILES | Cc1cccc(C2Nc3ccccc3C(=O)N2NC(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C21H17N5O4/c1-13-5-4-8-18(22-13)19-23-17-7-3-2-6-16(17)21(28)25(19)24-20(27)14-9-11-15(12-10-14)26(29)30/h2-12,19,23H,1H3,(H,24,27) |
| InChIKey | NDUDDYRBTWBKPT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 117.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|