C31H29N3O9 — CID 23912486
ethyl 2-[6-benzoyl-5-(4-methoxy-3-nitrophenyl)-7-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]acetate (PubChem CID 23912486) has the molecular formula C31H29N3O9 and a molecular weight of 587.59 g/mol. Its IUPAC name is ethyl 2-[6-benzoyl-5-(4-methoxy-3-nitrophenyl)-7-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]acetate.
| Compound Name | ethyl 2-[6-benzoyl-5-(4-methoxy-3-nitrophenyl)-7-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]acetate |
|---|---|
| PubChem CID | 23912486 |
| Molecular Formula | C31H29N3O9 |
| Molecular Weight | 587.59 g/mol |
| Exact Mass | 587.19 |
| IUPAC Name | ethyl 2-[6-benzoyl-5-(4-methoxy-3-nitrophenyl)-7-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazol-2-yl]acetate |
| SMILES | CCOC(=O)CN1C(=O)C2C(c3ccc(OC)cc3)C(C(=O)c3ccccc3)C(c3ccc(OC)c([N+](=O)[O-])c3)N2C1=O |
| InChI | InChI=1S/C31H29N3O9/c1-4-43-24(35)17-32-30(37)28-25(18-10-13-21(41-2)14-11-18)26(29(36)19-8-6-5-7-9-19)27(33(28)31(32)38)20-12-15-23(42-3)22(16-20)34(39)40/h5-16,25-28H,4,17H2,1-3H3 |
| InChIKey | GRDAPEKLCPLNIB-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 145.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|