C24H27FN4O4 — CID 134082815
2-[3-[4-(dimethylamino)phenyl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 134082815) has the molecular formula C24H27FN4O4 and a molecular weight of 454.50 g/mol. Its IUPAC name is 2-[3-[4-(dimethylamino)phenyl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-[3-[4-(dimethylamino)phenyl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 134082815 |
| Molecular Formula | C24H27FN4O4 |
| Molecular Weight | 454.50 g/mol |
| Exact Mass | 454.20 |
| IUPAC Name | 2-[3-[4-(dimethylamino)phenyl]-5-methyl-4,6-dioxo-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazol-2-yl]-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | CN1C(=O)C2ON(CC(=O)NCCc3ccc(F)cc3)C(c3ccc(N(C)C)cc3)C2C1=O |
| InChI | InChI=1S/C24H27FN4O4/c1-27(2)18-10-6-16(7-11-18)21-20-22(24(32)28(3)23(20)31)33-29(21)14-19(30)26-13-12-15-4-8-17(25)9-5-15/h4-11,20-22H,12-14H2,1-3H3,(H,26,30) |
| InChIKey | WXQOJIILWQOVMF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|