C14H12ClF3N4O2S2 — CID 3750787
methyl N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamimidothioate (PubChem CID 3750787) has the molecular formula C14H12ClF3N4O2S2 and a molecular weight of 424.86 g/mol. Its IUPAC name is methyl N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamimidothioate.
| Compound Name | methyl N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamimidothioate |
|---|---|
| PubChem CID | 3750787 |
| Molecular Formula | C14H12ClF3N4O2S2 |
| Molecular Weight | 424.86 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | methyl N'-(benzenesulfonyl)-N-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]carbamimidothioate |
| SMILES | CSC(=NS(=O)(=O)c1ccccc1)NNc1ncc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H12ClF3N4O2S2/c1-25-13(22-26(23,24)10-5-3-2-4-6-10)21-20-12-11(15)7-9(8-19-12)14(16,17)18/h2-8H,1H3,(H,19,20)(H,21,22) |
| InChIKey | ZEZOISMVICSVFF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.86 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|