C22H33BrO4 — CID 3754972
17-(2-bromoacetyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 3754972) has the molecular formula C22H33BrO4 and a molecular weight of 441.41 g/mol. Its IUPAC name is 17-(2-bromoacetyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | 17-(2-bromoacetyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 3754972 |
| Molecular Formula | C22H33BrO4 |
| Molecular Weight | 441.41 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 17-(2-bromoacetyl)-3,17-dihydroxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC12CCC3C(C(=O)CC4(C)C3CCC4(O)C(=O)CBr)C1(C)CCC(O)C2 |
| InChI | InChI=1S/C22H33BrO4/c1-19-7-5-14-15-6-9-22(27,17(26)12-23)21(15,3)11-16(25)18(14)20(19,2)8-4-13(24)10-19/h13-15,18,24,27H,4-12H2,1-3H3 |
| InChIKey | JLZAWPXFXHUIRQ-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.41 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|