C22H33NO2 — CID 99575992
(1S,2S,5S,9R,12S,13R,16R,18R)-16-hydroxy-6,13,18-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-11-one (PubChem CID 99575992) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is (1S,2S,5S,9R,12S,13R,16R,18R)-16-hydroxy-6,13,18-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-11-one.
| Compound Name | (1S,2S,5S,9R,12S,13R,16R,18R)-16-hydroxy-6,13,18-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-11-one |
|---|---|
| PubChem CID | 99575992 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | (1S,2S,5S,9R,12S,13R,16R,18R)-16-hydroxy-6,13,18-trimethyl-7-azapentacyclo[10.8.0.02,9.05,9.013,18]icos-6-en-11-one |
| SMILES | CC1=NC[C@]23CC(=O)[C@H]4[C@@H](CC[C@]5(C)C[C@H](O)CC[C@]45C)[C@@H]2CC[C@H]13 |
| InChI | InChI=1S/C22H33NO2/c1-13-16-4-5-17-15-7-8-20(2)10-14(24)6-9-21(20,3)19(15)18(25)11-22(16,17)12-23-13/h14-17,19,24H,4-12H2,1-3H3/t14-,15+,16-,17+,19-,20-,21-,22+/m1/s1 |
| InChIKey | VHGQZHONFLYAGQ-UDHQNBHYSA-N |
| XLogP | 4.03 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |