C19H24N2O6 — CID 3756463
N-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]amino]benzamide (PubChem CID 3756463) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]amino]benzamide.
| Compound Name | N-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 3756463 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[[5-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]amino]benzamide |
| SMILES | CC1(C)OCC(C2OC3OC(C)(C)OC3C2=NNC(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C19H24N2O6/c1-18(2)23-10-12(25-18)14-13(15-17(24-14)27-19(3,4)26-15)20-21-16(22)11-8-6-5-7-9-11/h5-9,12,14-15,17H,10H2,1-4H3,(H,21,22) |
| InChIKey | HITYJDWTJZLREJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|