C19H24N2O6 — CID 177423325
N-[(E)-[(3'aR,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-ylidene]amino]benzamide (PubChem CID 177423325) has the molecular formula C19H24N2O6 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[(E)-[(3'aR,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-ylidene]amino]benzamide.
| Compound Name | N-[(E)-[(3'aR,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 177423325 |
| Molecular Formula | C19H24N2O6 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | N-[(E)-[(3'aR,4R,7'aS)-2,2,2',2'-tetramethylspiro[1,3-dioxolane-4,6'-4,7a-dihydro-3aH-[1,3]dioxolo[4,5-c]pyran]-7'-ylidene]amino]benzamide |
| SMILES | CC1(C)O[C@@H]2CO[C@]3(COC(C)(C)O3)/C(=N/NC(=O)c3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C19H24N2O6/c1-17(2)24-11-19(27-17)15(14-13(10-23-19)25-18(3,4)26-14)20-21-16(22)12-8-6-5-7-9-12/h5-9,13-14H,10-11H2,1-4H3,(H,21,22)/b20-15+/t13-,14-,19+/m1/s1 |
| InChIKey | WPMGJDWOVMBITQ-XQCRUZGTSA-N |
| XLogP | 1.80 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|