C2H6O8P3-3 — CID 3758106
bis[[hydroxy(oxido)phosphoryl]methyl]phosphinate (PubChem CID 3758106) has the molecular formula C2H6O8P3-3 and a molecular weight of 250.98 g/mol. Its IUPAC name is bis[[hydroxy(oxido)phosphoryl]methyl]phosphinate.
| Compound Name | bis[[hydroxy(oxido)phosphoryl]methyl]phosphinate |
|---|---|
| PubChem CID | 3758106 |
| Molecular Formula | C2H6O8P3-3 |
| Molecular Weight | 250.98 g/mol |
| Exact Mass | 250.93 |
| IUPAC Name | bis[[hydroxy(oxido)phosphoryl]methyl]phosphinate |
| SMILES | O=P([O-])(O)CP(=O)([O-])CP(=O)([O-])O |
| InChI | InChI=1S/C2H9O8P3/c3-11(4,1-12(5,6)7)2-13(8,9)10/h1-2H2,(H,3,4)(H2,5,6,7)(H2,8,9,10)/p-3 |
| InChIKey | PQIDUOAVCWPOLB-UHFFFAOYSA-K |
| XLogP | -2.37 |
| TPSA | 160.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.98 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|