C18H23N5O6 — CID 3758637
N-(2-methoxy-5-nitrophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide (PubChem CID 3758637) has the molecular formula C18H23N5O6 and a molecular weight of 405.41 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 3758637 |
| Molecular Formula | C18H23N5O6 |
| Molecular Weight | 405.41 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-3-[(2-oxo-2-piperidin-1-ylacetyl)hydrazinylidene]butanamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CC(C)=NNC(=O)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C18H23N5O6/c1-12(20-21-17(25)18(26)22-8-4-3-5-9-22)10-16(24)19-14-11-13(23(27)28)6-7-15(14)29-2/h6-7,11H,3-5,8-10H2,1-2H3,(H,19,24)(H,21,25) |
| InChIKey | BQNUPYPBWOGXGM-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 143.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|