C22H25NO — CID 3760324
1,3-diethyl-4-methyl-4,6-diphenyl-3H-pyridin-2-one (PubChem CID 3760324) has the molecular formula C22H25NO and a molecular weight of 319.45 g/mol. Its IUPAC name is 1,3-diethyl-4-methyl-4,6-diphenyl-3H-pyridin-2-one.
| Compound Name | 1,3-diethyl-4-methyl-4,6-diphenyl-3H-pyridin-2-one |
|---|---|
| PubChem CID | 3760324 |
| Molecular Formula | C22H25NO |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.19 |
| IUPAC Name | 1,3-diethyl-4-methyl-4,6-diphenyl-3H-pyridin-2-one |
| SMILES | CCC1C(=O)N(CC)C(c2ccccc2)=CC1(C)c1ccccc1 |
| InChI | InChI=1S/C22H25NO/c1-4-19-21(24)23(5-2)20(17-12-8-6-9-13-17)16-22(19,3)18-14-10-7-11-15-18/h6-16,19H,4-5H2,1-3H3 |
| InChIKey | NIGPHELQESDFAT-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |